1. Ethanol is produced by the hydration of ethylene. Some of the ethanol product is converted in an undesired side reaction to diethyl ether and water. C2H4 (g) + HO (l) C2H5OH (l) 2 C2H5OH (I) (C2H5)2O (l) + HO (l) The feeds to the reactor are ethylene gas and liquid water, each @ 25C, 1 atm. A sample of the stream exiting the reactor is analyzed and found to be 15C and contain 43.3 mol % ethylene (g), 2.5% ethanol (I), 0.14% ether (I), and the rest water (I). Assuming a basis of 100 moles in the exit stream, calculate the molar composition of the feed. Calculate the heat released or absorbed (specify which) from the reactor using the heat of formation method. For the Cp values from Table B.2 in your text, you may use just the "a" and "b" terms for simplicity.

Ethanol is produced by the hydration of ethylene. Some of the ethanol product is converted in an undesired side reaction to diethyl ether and water. C2H4(g)+H2O(I)C2H5OH(I)2C2H5OH(I)(C2H5)2O(I)+H2O(I) The feeds to the reactor are ethylene gas and liquid water, each @ 25 C,1atm. A sample of the stream exiting the reactor is analyzed and found to be 15C and contain 43.3 mol % ethylene (g),2.5% ethanol (I),0.14% ether (I), and the rest water (I). Assuming a basis of 100 moles in the exit stream, calculate the molar composition of the feed. Calculate the heat released or absorbed (specify which) from the reactor using the heat of formation method. For the Cp values from Table B.2 in your text, you may use just the "a" and "b" terms for simplicity