A 55.0mL sample of a 0.112M potassium sullate solution is mixed with 39.5mL of a 0.114M lead(II) acetate solution and the following precipitation reaction occurs: K2SO4(aq)+Pb(C2H3O2)2(aq)2KC2H3O2(aq)+PbSO4(s) The solid PbSO4 is collected, dried, and found to have a mass of 1.00g. Determine the limiting reactant, the theoretical yield, and the percent yield. Part A Identily the limiting reactant. PbSO4K2SO4Pb(C2H3O2)2KC2H3O2 Part B Determine the theoretical yleld. Determine the percent yield