Hexamethylenediamine (C6H10N2) is one of the starting materials for the production of nylon. It can be prepared from adipic acid (C6H10O4) by the following overall equation: C6H10O4(l)+2NH3(g)+4H2(g)C6H16N2(l)+4H2O(l) What is the percent yleld for the reaction if 1.27103g of hexamethylenediamine is made from 1.891039 of adipic acid? Percent yield = % 8 more group attempts remaining For the following reaction, 4.37 grams of hydrogen gas are mixed with excess nitrogen gas . The reaction yields 20.6 grams of ammonia . nitrogen(g)+hydrogen(g)ammonia(g) What is the theoretical yield of ammonia? grams What is the percent yleld for this reaction ? % 9 more group attempts remaining For the following reaction, 5.14 grams of aluminum are mixed with excess iron(III) oxide. The reaction yields 8.98 grams of aluminum oxide. iron(III)oxide(s)+aluminum(s)aluminumoxide(s)+iron(s) What is the theoretical yield of aluminum oxide? grams What is the percent yield of aluminum oxide ? %